|
CAS#: 60346-04-5 Product: Crinitol No suppilers available for the product. |
| Name | Crinitol |
|---|---|
| Synonyms | 2,6,10,14-Hexadecatetraene-1,9-Diol, 3,7,11,15-Tetramethyl-, (R-(E,E,E))-; Crinitol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 |
| CAS Registry Number | 60346-04-5 |
| SMILES | [C@H](/C=C(/CCC=C(C)C)C)(C/C(=C/CC/C(=C/CO)C)C)O |
| InChI | 1S/C20H34O2/c1-16(2)8-6-10-18(4)14-20(22)15-19(5)11-7-9-17(3)12-13-21/h8,11-12,14,20-22H,6-7,9-10,13,15H2,1-5H3/b17-12+,18-14+,19-11+/t20-/m0/s1 |
| InChIKey | FVDBKWBFRSVIAW-UJXSZHEFSA-N |
| Density | 0.935g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.917°C at 760 mmHg (Cal.) |
| Flash point | 188.126°C (Cal.) |
| (1) | Sally Dixon, George J. Gordon and Richard J. Whitby. Zirconium mediated total synthesis of crinitol, 9-hydroxyfarnesoic acid, 9-hydroxyfarnesol, 9-hydroxysargaquinone and the selectively-protected aglycone of moritoside and euplexide A, Chem. Commun., 2005, 0, 4303. |
|---|---|
| Market Analysis Reports |