| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4,4'-Biphenyldiyl Dibenzoate |
|---|---|
| Synonyms | 4-(4-phenylcarbonyloxyphenyl)phenyl benzoate; 4'-(Benzoyloxy)[1,1'-biphenyl]-4-yl benzoate #; 4,4′-bis(benzoyloxy)biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C26H18O4 |
| Molecular Weight | 394.42 |
| CAS Registry Number | 60469-90-1 |
| SMILES | O=C(Oc1ccc(cc1)c3ccc(OC(=O)c2ccccc2)cc3)c4ccccc4 |
| InChI | 1S/C26H18O4/c27-25(21-7-3-1-4-8-21)29-23-15-11-19(12-16-23)20-13-17-24(18-14-20)30-26(28)22-9-5-2-6-10-22/h1-18H |
| InChIKey | QPBOLOMIFWOGKZ-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.544°C at 760 mmHg (Cal.) |
| Flash point | 286.786°C (Cal.) |
| (1) | Keiki Kishikawa, Sumihiro Aikyo, Seiji Akiyama, Takahiro Inoue, Masahiro Takahashi, Shiki Yagai, Hiroaki Aonuma and Shigeo Kohmoto. Realization of a lateral directional order in nematic and smectic A phases of rodlike molecules by using perfluoroarene–arene interactions, Soft Matter, 2011, 7, 5176. |
|---|---|
| Market Analysis Reports |