Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Dyes and pigments >> Dyes >> Disperse dye |
|---|---|
| Name | Disperse Black 1 |
| Synonyms | 4-(4-Aminophenyl)Azonaphthalen-1-Amine; 4-(4-Aminophenyl)Azo-1-Naphthalenamine; [4-(4-Aminophenyl)Azo-1-Naphthyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.31 |
| CAS Registry Number | 6054-48-4 |
| EINECS | 227-966-8 |
| SMILES | C1=CC=CC2=C(C=CC(=C12)N=NC3=CC=C(N)C=C3)N |
| InChI | 1S/C16H14N4/c17-11-5-7-12(8-6-11)19-20-16-10-9-15(18)13-3-1-2-4-14(13)16/h1-10H,17-18H2 |
| InChIKey | QDPSGELUBXFKSB-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.292°C at 760 mmHg (Cal.) |
| Flash point | 264.23°C (Cal.) |
| Market Analysis Reports |