| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Sinova Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (301) 961-1525 | |||
![]() |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | 2-Hydroxyisophthalic acid |
|---|---|
| Synonyms | 2-Hydroxyisophthalic Acid; Nsc 252689; 1,3-Benzenedicarboxylic Acid, 2-Hydroxy- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 |
| CAS Registry Number | 606-19-9 |
| SMILES | C1=CC=C(C(=C1C(O)=O)O)C(O)=O |
| InChI | 1S/C8H6O5/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | WVDGHGISNBRCAO-UHFFFAOYSA-N |
| Density | 1.613g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.25°C at 760 mmHg (Cal.) |
| Flash point | 211.838°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Muhammad Arif Nadeem, Aaron W. Thornton, Matthew R. Hill and John Arron Stride. A flexible copper based microporous metal–organic framework displaying selective adsorption of hydrogen over nitrogen, Dalton Trans., 2011, 40, 3398. |
|---|---|
| Market Analysis Reports |