| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Periodobenzene |
|---|---|
| Synonyms | P-Iodoanil; Inchi=1/C6i6/C7-1-2(8)4(10)6(12)5(11)3(1) |
| Molecular Structure | ![]() |
| Molecular Formula | C6I6 |
| Molecular Weight | 833.49 |
| CAS Registry Number | 608-74-2 |
| EINECS | 210-169-4 |
| SMILES | C1(=C(C(=C(C(=C1I)I)I)I)I)I |
| InChI | 1S/C6I6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | QNMKKFHJKJJOMZ-UHFFFAOYSA-N |
| Density | 3.757g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.707°C at 760 mmHg (Cal.) |
| Flash point | 291.255°C (Cal.) |
| (1) | Kristýna Pluhá?ková, Petr Jure?ka and Pavel Hobza. Stabilisation energy of CH?CX (X = F, Cl, Br, I, CN) complexes: complete basis set limit calculations at MP2 and CCSD(T) levels, Phys. Chem. Chem. Phys., 2007, 9, 755. |
|---|---|
| Market Analysis Reports |