| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 3-Formylsalicylic Acid |
|---|---|
| Synonyms | 3-Formyl-2-Hydroxy-Benzoic Acid; 2-Hydroxy-3-Methanoyl-Benzoic Acid; Nsc55753 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 |
| CAS Registry Number | 610-04-8 |
| SMILES | C1=C(C(=C(C=C1)C=O)O)C(O)=O |
| InChI | 1S/C8H6O4/c9-4-5-2-1-3-6(7(5)10)8(11)12/h1-4,10H,(H,11,12) |
| InChIKey | YOEUNKPREOJHBW-UHFFFAOYSA-N |
| Density | 1.483g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.864°C at 760 mmHg (Cal.) |
| Flash point | 153.61°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Mannar R. Maurya, Maneesh Kumar, Amit Kumar and João Costa Pessoa. Oxidation of p-chlorotoluene and cyclohexene catalysed by polymer-anchored oxovanadium(iv) and copper(ii) complexes of amino acid derived tridentate ligands, Dalton Trans., 2008, 4220. |
|---|---|
| Market Analysis Reports |