| Pribolab Pte. Ltd. | Singapore | |||
|---|---|---|---|---|
![]() | www.pribolab.com | |||
![]() | +86 4006885349 | |||
![]() | sales@pribolab.com | |||
| Chemical manufacturer since 2008 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Classification | Analytical chemistry >> Standard >> Food and cosmetics standards |
|---|---|
| Name | Tenuazonic acid |
| Synonyms | 4-Acetyl-2-butan-2-yl-3-hydroxy-1,2-dihydropyrrol-5-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 |
| CAS Registry Number | 610-88-8 |
| EC Number | 636-400-2 |
| SMILES | CCC(C)C1C(=C(C(=O)N1)C(=O)C)O |
| Solubility | 1.254e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.519, Calc.* |
| Melting point | 152.55 °C |
| Boiling Point | 393.86 °C, 401.1±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 196.4±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H301 Details | ||||||||||||||||||||
| Safety Statements | P264-P270-P301+P316-P321-P330-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |