| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3,3'-Dihydroxybiphenyl |
|---|---|
| Synonyms | (1,1'-Biphenyl)-3,3'-Diol; St5446436; (1,1'-Biphenyl)-Ar,3-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 612-76-0 (68334-50-9) |
| SMILES | C2=C(C1=CC=CC(=C1)O)C=CC=C2O |
| InChI | 1S/C12H10O2/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8,13-14H |
| InChIKey | VZQSBJKDSWXLKX-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.904°C at 760 mmHg (Cal.) |
| Flash point | 210.407°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Pier Lucio Anelli, Marino Brocchetta, (the late) Costantino Maffezzoni, Paola Paoli, Patrizia Rossi, Fulvio Uggeri and Massimo Visigalli. Syntheses and X-ray crystal structures of derivatives of 2,2',4,4',6,6'-hexaiodobiphenyl, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1175. |
|---|---|
| Market Analysis Reports |