| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 2,2'-Binaphthyl |
|---|---|
| Synonyms | 2-(2-Naphthyl)Naphthalene; 2,2'-Binaphthyl (8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 |
| CAS Registry Number | 612-78-2 |
| EINECS | 210-320-4 |
| SMILES | C1=C(C=CC2=C1C=CC=C2)C3=CC4=C(C=C3)C=CC=C4 |
| InChI | 1S/C20H14/c1-3-7-17-13-19(11-9-15(17)5-1)20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| InChIKey | MSBVBOUOMVTWKE-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Melting point | 187°C (Expl.) |
| Boiling point | 428.866°C at 760 mmHg (Cal.) |
| Flash point | 206.329°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Margaret A. Brimble and Michelle Y. H. Lai. Suzuki–Miyaura homocoupling of naphthyl triflates using bis(pinacolato)diboron: approaches to the biaryl skeleton of crisamicin A, Org. Biomol. Chem., 2003, 1, 2084. |
|---|---|
| Market Analysis Reports |