| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| ChemSampCo, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 656-2440 | |||
![]() |
sales@chemsampco.com | |||
| Chemical manufacturer since 1960 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 2-Phenylnaphthalene |
|---|---|
| Synonyms | Nsc 407592; Naphthalene, 2-Phenyl- (8Ci)(9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 612-94-2 |
| EINECS | 210-324-6 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2)C3=CC=CC=C3 |
| InChI | 1S/C16H12/c1-2-6-13(7-3-1)16-11-10-14-8-4-5-9-15(14)12-16/h1-12H |
| InChIKey | TURIHPLQSRVWHU-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Melting point | 105°C (Expl.) |
| Boiling point | 345.498°C at 760 mmHg (Cal.) |
| Flash point | 155.862°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Meledathu C. Sajimon and Frederick D. Lewis. Photocyclization of 2-vinyldiphenylacetylenes and behavior of the isonaphthalene intermediates, Photochem. Photobiol. Sci., 2005, 4, 629. |
|---|---|
| Market Analysis Reports |