| Anhui Primechem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.primekem.com | |||
![]() | +86 (551) 6283-5529 | |||
![]() | henry@primekem.com | |||
| Chemical distributor since 2009 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Methyl 2-heptyl-4,6-dihydroxybenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 |
| CAS Registry Number | 6121-77-3 |
| SMILES | CCCCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.534, Calc.* |
| Boiling Point | 431.8±30.0 °C (760 mmHg), Calc.* |
| Flash Point | 156.6±18.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |