| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-(N,N-Dipropylamino)benzaldehyde |
|---|---|
| Synonyms | Nsc156559; Benzaldehyde, 4-(Dipropylamino)-; 4-(N,N-Dipropylamino)Benzaldehyde |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 |
| CAS Registry Number | 613-28-5 |
| EINECS | 210-334-0 |
| SMILES | C1=C(C=CC(=C1)N(CCC)CCC)C=O |
| InChI | 1S/C13H19NO/c1-3-9-14(10-4-2)13-7-5-12(11-15)6-8-13/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | HDOZLDYBGNJMMZ-UHFFFAOYSA-N |
| Density | 1.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.553°C at 760 mmHg (Cal.) |
| Flash point | 117.96°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Zhao-Ming Xue, Yu-Peng Tian, Dong Wang and Min-Hua Jiang. One- and two-photon excited dual fluorescence properties of zinc(ii) and cadmium(ii) complexes containing 4-dipropylaminobenzaldehyde thiosemicarbazone, Dalton Trans., 2003, 0, 1373. |
|---|---|
| Market Analysis Reports |