| Hangzhou Verychem Science And Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.verychem.com | |||
![]() | +86 (571) 8816-2785 +86 13606544505 | |||
![]() | +86 (571) 8816-2787 | |||
![]() | lucy@verychem.com | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink Massive supplier since 2021 | ||||
| Classification | Organic raw materials >> Ketone compound |
|---|---|
| Name | (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C27H52O4Si2 |
| Molecular Weight | 496.87 |
| CAS Registry Number | 61628-05-5 |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1CC(=O)O2)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| Solubility | 2.281e-005 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.476, Calc.* |
| Melting point | 182.40 °C |
| Boiling Point | 476.87 °C, 514.8±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 220.2±25.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
The chemical substance (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one is a complex organic compound that belongs to the class of silyl ether derivatives. This structure incorporates a cyclopenta[b]furanone core, which is a heterocyclic ring system, with additional functional groups such as a tert-butyl(dimethyl)silyl ether, which provides enhanced stability and reactivity in certain chemical environments. The discovery of this compound is situated within the broader research on the synthesis of modified organic molecules, particularly those incorporating silyl groups, which are often used to alter the physical and chemical properties of organic compounds. Silyl groups, such as the tert-butyl(dimethyl)silyl group present in this molecule, are commonly used in organic synthesis for the protection of reactive functional groups, improving the solubility of compounds in nonpolar solvents, and enhancing stability under various reaction conditions. This compound is typically used in synthetic organic chemistry as a building block or intermediate for the development of more complex molecules. The presence of the silyl ether groups plays a critical role in the compound's ability to undergo specific chemical reactions, such as nucleophilic substitutions, which are essential in the synthesis of pharmaceuticals and other high-value chemical products. The use of the cyclopenta[b]furanone structure in the molecule further contributes to its utility, as this fused-ring system is often found in biologically active compounds, contributing to the molecular interactions that may lead to therapeutic effects. The specific application of (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one has been explored in the context of chemical and pharmaceutical research. The structural features of this molecule make it a valuable intermediate in the synthesis of bioactive compounds, where the presence of the silyl protecting groups can enhance the stability and reactivity of the molecule. This is particularly important in drug discovery and the development of new chemical entities that may act as therapeutic agents. The application of this compound in medicinal chemistry has been part of efforts to design molecules with enhanced bioavailability, stability, and selective reactivity. Its incorporation into more complex molecular architectures could potentially lead to compounds with desirable properties for use in pharmaceuticals. Additionally, the stereochemistry and functional group arrangement in this molecule may impart specificity in interactions with biological targets, though the precise biological activities of this compound have not been widely documented in the available literature. In conclusion, (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one is a synthetic organic compound used primarily as an intermediate in organic synthesis. Its structure, which includes silyl ether and cyclopenta[b]furanone moieties, enables its use in the preparation of other complex molecules, particularly in the context of drug development and chemical research. References none |
| Market Analysis Reports |