| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | N-(2-Methylphenyl)-2-Methylbenzenamine |
|---|---|
| Synonyms | Bis(2-Methylphenyl)Amine; Benzenamine, 2-Methyl-N-(2-Methylphenyl)-; Di-O-Tolylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 617-00-5 |
| SMILES | C1=CC=CC(=C1C)NC2=CC=CC=C2C |
| InChI | 1S/C14H15N/c1-11-7-3-5-9-13(11)15-14-10-6-4-8-12(14)2/h3-10,15H,1-2H3 |
| InChIKey | WONYVCKUEUULQN-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.681°C at 760 mmHg (Cal.) |
| Flash point | 147.121°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Raymond B. Lansing, Karen I. Goldberg and Richard A. Kemp. Unsymmetrical RPNPR pincer ligands and their group 10 complexes, Dalton Trans., 2011, 40, 8950. |
|---|---|
| Market Analysis Reports |