| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1,3-Diphenylcarbodiimide |
|---|---|
| Synonyms | Phenyl-(Phenyliminomethylene)Amine; Benzenamine, N,N'-Methanetetraylbis-; Carbodiimide, Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 |
| CAS Registry Number | 622-16-2 |
| EINECS | 210-721-4 |
| SMILES | C2=C(N=C=NC1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C13H10N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13/h1-10H |
| InChIKey | CMESPBFFDMPSIY-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.999°C at 760 mmHg (Cal.) |
| Flash point | 146.089°C (Cal.) |
| (1) | Makoto Nitta, Yuhki Mitsumoto and Hiroyuki Yamamoto. Synthesis, structure, and reactivity of (tropon-2-ylimino)arsorane and in situ generation of its stiborane and -bismuthorane analogues: reactions with heterocumulenes and an activated acetylene giving heteroazulenes, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1901. |
|---|---|
| Market Analysis Reports |