|
CAS#: 62258-49-5 Product: (1-Methylethenyl)-Benzene Polymer With 2-Methyl-2-Butene And 1,3-Pentadiene No suppilers available for the product. |
| Name | (1-Methylethenyl)-Benzene Polymer With 2-Methyl-2-Butene And 1,3-Pentadiene |
|---|---|
| Synonyms | Isopropenylbenzene; 2-Methylbut-2-Ene; (3E)-Penta-1,3-Diene; Amylene; Isopropenylbenzene; Piperylene |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 |
| CAS Registry Number | 62258-49-5 |
| SMILES | CC(=CC)C.C\C=C\C=C.C1=CC=CC(=C1)C(C)=C |
| InChI | 1S/C9H10.C5H10.C5H8/c1-8(2)9-6-4-3-5-7-9;1-4-5(2)3;1-3-5-4-2/h3-7H,1H2,2H3;4H,1-3H3;3-5H,1H2,2H3/b;;5-4+ |
| InChIKey | ALYUQJJURXCZBB-XMOYFUIDSA-N |
| Boiling point | 162.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 45.6°C (Cal.) |
| Market Analysis Reports |