| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Zinc Succinate |
|---|---|
| Synonyms | Zinc Succinate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4O4Zn |
| Molecular Weight | 181.45 |
| CAS Registry Number | 6228-53-1 |
| EINECS | 228-331-8 |
| SMILES | C(C([O-])=O)CC([O-])=O.[Zn++] |
| InChI | 1S/C4H6O4.Zn/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | AGFGXVAAIXIOFZ-UHFFFAOYSA-L |
| Boiling point | 236.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.9°C (Cal.) |
| (1) | Thomas A. Bowden, Heather L. Milton, Alexandra M. Z. Slawin and Philip Lightfoot. Hydrothermal syntheses and crystal structures of three zinc succinates: Zn(CHO)-a, Zn(CHO)-ß and KZn(CHO), Dalton Trans., 2003, 0, 936. |
|---|---|
| Market Analysis Reports |