| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,1,2,2,3,3,4,4,5,5-Decachloropentasilolane |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,5,5-Decachloro-1,2,3,4,5-Pentasilolane; Silacyclopentane, Decachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | Cl10Si5 |
| Molecular Weight | 494.96 |
| CAS Registry Number | 62436-46-8 |
| SMILES | Cl[Si]1([Si]([Si]([Si]([Si]1(Cl)Cl)(Cl)Cl)(Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/Cl10Si5/c1-11(2)12(3,4)14(7,8)15(9,10)13(11,5)6 |
| InChIKey | MXGAXRZKRJCVRU-UHFFFAOYSA-N |
| Density | 1.624g/cm3 (Cal.) |
|---|---|
| (1) | Xuliang Dai, Kenneth J. Anderson, Douglas L. Schulz and Philip Boudjouk. Coordination chemistry of Si5Cl10 with organocyanides, Dalton Trans., 2010, 39, 11188. |
|---|---|
| Market Analysis Reports |