| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Name | {(1R,2S)-3-Oxo-2-[(2Z)-2-Penten-1-Yl]Cyclopentyl}Acetic Acid |
|---|---|
| Synonyms | (+)-7-isojasmonic acid; (+)-7-iso-Jasmonic acid; (±)7-epi Jasmonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 |
| CAS Registry Number | 62653-85-4 |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(=O)CC1)C\C=C/CC |
| InChI | 1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+/m1/s1 |
| InChIKey | ZNJFBWYDHIGLCU-QKMQQOOLSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.126°C at 760 mmHg (Cal.) |
| Flash point | 184.578°C (Cal.) |
| (1) | Hisato Nonaka, Narihito Ogawa, Noriaki Maeda, Yong-Gang Wang and Yuichi Kobayashi. Stereoselective synthesis of epi-jasmonic acid, tuberonic acid, and 12-oxo-PDA, Org. Biomol. Chem., 2010, 8, 5212. |
|---|---|
| Market Analysis Reports |