| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | Calcium Acrylate |
|---|---|
| Synonyms | Calcium Acrylate; Nsc 8259 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6CaO4 |
| Molecular Weight | 182.19 |
| CAS Registry Number | 6292-01-9 |
| EINECS | 228-547-2 |
| SMILES | O=C([O-])C=C.O=C([O-])C=C.[Ca++] |
| InChI | 1S/2C3H4O2.Ca/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | TXTCTCUXLQYGLA-UHFFFAOYSA-L |
| Boiling point | 141°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 61.6°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | G. Hofstätter, W. Prandl, T. Brückel and W. Hiller. X-ray and neutron investigation of the structure and disorder in dicalcium barium acrylate, Acta Cryst. (1994). B50, 448-455 |
|---|---|
| Market Analysis Reports |