| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Benzquinamide |
|---|---|
| Synonyms | Acetic Acid [3-(Diethylamino-Oxomethyl)-9,10-Dimethoxy-2,3,4,6,7,11B-Hexahydro-1H-Pyrido[2,1-A]Isoquinolin-2-Yl] Ester; Acetic Acid [3-(Diethylcarbamoyl)-9,10-Dimethoxy-2,3,4,6,7,11B-Hexahydro-1H-Pyrido[2,1-A]Isoquinolin-2-Yl] Ester; [3-(Diethylcarbamoyl)-9,10-Dimethoxy-2,3,4,6,7,11B-Hexahydro-1H-Pyrido[2,1-A]Isoquinolin-2-Yl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 |
| CAS Registry Number | 63-12-7 |
| SMILES | C3=C2C1N(CC(C(N(CC)CC)=O)C(C1)OC(C)=O)CCC2=CC(=C3OC)OC |
| InChI | 1S/C22H32N2O5/c1-6-23(7-2)22(26)17-13-24-9-8-15-10-20(27-4)21(28-5)11-16(15)18(24)12-19(17)29-14(3)25/h10-11,17-19H,6-9,12-13H2,1-5H3 |
| InChIKey | JSZILQVIPPROJI-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 274.9±30.1°C (Cal.) |
| (1) | Atsushi Ishikawa, Yoshihide Nakao, Hirofumi Sato and Shigeyoshi Sakaki. Pd(ii)-promoted direct cross-coupling reaction of arenes via highly regioselective aromatic C–H activation: a theoretical study, Dalton Trans., 2010, 39, 3279. |
|---|---|
| Market Analysis Reports |