| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Hydroxychrysene |
|---|---|
| Synonyms | 1-Chrysenol; 1-Hydroxychrysene; 3-06-00-03728 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 63019-38-5 |
| SMILES | C1=CC4=C(C2=C1C3=C(C=C2)C=CC=C3)C=CC=C4O |
| InChI | 1S/C18H12O/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18/h1-11,19H |
| InChIKey | ISHBWEUQYFEVES-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.238°C at 760 mmHg (Cal.) |
| Flash point | 240.379°C (Cal.) |
| (1) | Elisa Bandini, Pietro Bortolus, Ilse Manet, Sandra Monti, Guido Galiazzo and Giorgio Gennari. Photoisomerization and photohydration of 3-hydroxystyrylnaphthalenes, Photochem. Photobiol. Sci., 2005, 4, 862. |
|---|---|
| Market Analysis Reports |