| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 9-Hydroxy-9-Methylfluorene |
|---|---|
| Synonyms | 9-Methyl-9-Fluorenol; 9-Hydroxy-9-Methylfluorene; 9-Mf-Oh |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 6311-22-4 |
| SMILES | C1=CC=CC3=C1C2=C(C=CC=C2)C3(C)O |
| InChI | 1S/C14H12O/c1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9,15H,1H3 |
| InChIKey | ZMXJQEIJNHMYDY-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.346°C at 760 mmHg (Cal.) |
| Flash point | 133.107°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | D. G. Morris, K. W. Muir and K. S. Ryder. The low-temperature phase transition of 9-methylfluoren-9-ol: comparison of the crystal structures at 100 and 200Â K, Acta Cryst. (2002). C58, o615-o618 |
|---|---|
| Market Analysis Reports |