| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 9-Hydroxyfluorene-9-Carboxylate |
|---|---|
| Synonyms | 9-Hydroxy-9-Fluorenecarboxylic Acid Ethyl Ester; 9-Hydroxyfluorene-9-Carboxylic Acid Ethyl Ester; Nsc43862 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 6328-78-5 |
| SMILES | C1=CC=CC2=C1C(C3=C2C=CC=C3)(C(=O)OCC)O |
| InChI | 1S/C16H14O3/c1-2-19-15(17)16(18)13-9-5-3-7-11(13)12-8-4-6-10-14(12)16/h3-10,18H,2H2,1H3 |
| InChIKey | ZIIRWAAFDVUMKT-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.762°C at 760 mmHg (Cal.) |
| Flash point | 126.821°C (Cal.) |
| (1) | X.-Y. Dai, L.-F. Jin, F.-H. Song and B.-C. Wu. Ethyl 9-hydroxyfluorene-9-carboxylate: chains of centrosymmetric rings built from O-H...O and C-H...[pi](arene) hydrogen bonds, Acta Cryst. (2006). E62, o5340-o5342 |
|---|---|
| Market Analysis Reports |