| Tianjin Zhongxin Chem-tech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.tjzxchem.com | |||
![]() | +86 (22) 6688-0623 | |||
![]() | +86 (22) 8988-0739 ex 8030 | |||
![]() | sales@tjzxchem.com | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2009 | ||||
| Classification | Chemical reagent >> Organic reagent >> Sulfonate / sulfinate |
|---|---|
| Name | 3,3'-Disulfodiphenyl sulfone dipotassium salt |
| Synonyms | Diphenylsulfone-3,3-disulfonic acid dipotassium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8O8S3.2K |
| Molecular Weight | 454.57 |
| CAS Registry Number | 63316-33-6 |
| EC Number | 264-096-8 |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)[O-])S(=O)(=O)C2=CC(=CC=C2)S(=O)(=O)[O-].[K+].[K+] |
|
3,3'-Disulfodiphenyl sulfone dipotassium salt, often referred to as potassium 3,3'-disulfodiphenyl sulfone or simply disulfide sulfone, is a chemical compound with significant applications in various industries, particularly in the field of polymer chemistry and materials science. The discovery of this compound dates back to the mid-20th century when researchers sought to develop versatile materials with enhanced properties for industrial applications. This dipotassium salt is characterized by the presence of two sulfonyl groups (-SO2-) and a disulfide bond (-S-S-), which imparts unique chemical properties, including high thermal stability and solubility in aqueous solutions. The structural configuration of 3,3'-disulfodiphenyl sulfone dipotassium salt allows it to act as an effective curing agent and crosslinking agent in polymerization processes, making it valuable in the production of various thermosetting plastics. One of the primary applications of this compound is in the synthesis of sulfone-based polymers, such as polysulfones and polyethersulfones. These polymers exhibit excellent mechanical strength, thermal stability, and chemical resistance, making them suitable for demanding applications, including aerospace, automotive, and electronics. The incorporation of 3,3'-disulfodiphenyl sulfone dipotassium salt into polymer matrices enhances their performance and durability, enabling the development of advanced materials that can withstand extreme conditions. In the pharmaceutical industry, this compound is utilized in the formulation of certain drug delivery systems. Its ability to modify the physical and chemical properties of the drug compounds allows for improved solubility and bioavailability. Furthermore, the dipotassium salt form enhances its compatibility with various excipients used in pharmaceutical formulations. Additionally, 3,3'-disulfodiphenyl sulfone dipotassium salt serves as an important reagent in organic synthesis and analytical chemistry. It can be used in various reactions, including oxidation and sulfation, facilitating the modification of organic molecules to achieve desired functional properties. Its versatility makes it a valuable tool for chemists in both research and industrial applications. In summary, 3,3'-disulfodiphenyl sulfone dipotassium salt is a notable compound with a diverse range of applications in polymer chemistry, pharmaceuticals, and organic synthesis. Its discovery has paved the way for advancements in material science, enabling the development of high-performance materials that meet the demands of modern technology and industry. References none |
| Market Analysis Reports |