| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-(4-Nitrophenoxy)Anisole |
|---|---|
| Synonyms | Maybridge1_007935; Oprea1_206414; Nsc39657 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 |
| CAS Registry Number | 6337-24-2 |
| EINECS | 228-722-3 |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)OC)[N+](=O)[O-] |
| InChI | 1S/C13H11NO4/c1-17-11-6-8-13(9-7-11)18-12-4-2-10(3-5-12)14(15)16/h2-9H,1H3 |
| InChIKey | NBCQLWNLTLMGCB-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.006°C at 760 mmHg (Cal.) |
| Flash point | 155.53°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Archan Dey and Gautam R. Desiraju. Correlation between molecular dipole moment and centrosymmetry in some crystalline diphenyl ethers, Chem. Commun., 2005, 0, 2486. |
|---|---|
| Market Analysis Reports |