|
CAS#: 634-19-5 Product: Phentydrone No suppilers available for the product. |
| Name | Phentydrone |
|---|---|
| Synonyms | 4-07-00-01302 (Beilstein Handbook Reference); 9H-Fluoren-9-One, 1,2,3,4-Tetrahydro-; Brn 2615049 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 |
| CAS Registry Number | 634-19-5 |
| SMILES | C1=CC=CC2=C1C3=C(C2=O)CCCC3 |
| InChI | 1S/C13H12O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1,3,5,7H,2,4,6,8H2 |
| InChIKey | PWTXAEYNCISTMB-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.198°C at 760 mmHg (Cal.) |
| Flash point | 150.674°C (Cal.) |
| (1) | Keith Smith, Gamal A. El-Hiti and Amany S. Hegazy. One-pot synthesis of substituted isoindolin-1-ones via lithiation and substitution of N′-benzyl-N,N-dimethylureas, Chem. Commun., 2010, 46, 2790. |
|---|---|
| Market Analysis Reports |