| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1-Fluorenol |
|---|---|
| Synonyms | Fluoren-1-Ol; Nsc51310; Zinc01231941 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 |
| CAS Registry Number | 6344-61-2 |
| SMILES | C3=C2C1=C(C=CC=C1)CC2=C(C=C3)O |
| InChI | 1S/C13H10O/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h1-7,14H,8H2 |
| InChIKey | PWFLISNWYDWJHX-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.573°C at 760 mmHg (Cal.) |
| Flash point | 165.914°C (Cal.) |
| (1) | Jeffrey C. Roberts, Zachary M. Hudson and Robert P. Lemieux. The influence of alkoxy chain length on the ferroelectric properties of chiral fluorenol liquid crystals, J. Mater. Chem., 2008, 18, 3361. |
|---|---|
| Market Analysis Reports |