| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Livchem Logistics GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (69) 3800-2330 | |||
![]() |
customerservice@livchem.com | |||
| Chemical distributor | ||||
| SelectLab Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (2383) 919-350 / 919-351 | |||
![]() |
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| Name | 1,1'-Oxybis(2,4,6-Trinitrobenzene) |
|---|---|
| Synonyms | 1,1'-Oxybis(2,4,6-Trinitrobenzene) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4N6O13 |
| Molecular Weight | 440.20 |
| CAS Registry Number | 63441-08-7 |
| EINECS | 264-146-9 |
| SMILES | C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C(=C1[N+]([O-])=O)OC2=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C2[N+]([O-])=O |
| InChI | 1S/C12H4N6O13/c19-13(20)5-1-7(15(23)24)11(8(2-5)16(25)26)31-12-9(17(27)28)3-6(14(21)22)4-10(12)18(29)30/h1-4H |
| InChIKey | FMGQOJATXJFNGA-UHFFFAOYSA-N |
| Density | 1.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.351°C at 760 mmHg (Cal.) |
| Flash point | 203.439°C (Cal.) |
| (1) | Orion B. Berryman and Darren W. Johnson. Experimental evidence for interactions between anions and electron-deficient aromatic rings, Chem. Commun., 2009, 3143. |
|---|---|
| Market Analysis Reports |