| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,4'-(1,1,3,3-Tetramethyl-1,3-disiloxanediyl)dipyridine |
|---|---|
| Synonyms | 1,1,3,3-tetramethyl-1,3-di(pyridin-4-yl)disiloxane; 1,3-bis(4-pyridyl)tetramethyldisiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2OSi2 |
| Molecular Weight | 288.49 |
| CAS Registry Number | 634595-31-6 |
| SMILES | C[Si](C)(c1ccncc1)O[Si](C)(C)c2ccncc2 |
| InChI | 1S/C14H20N2OSi2/c1-18(2,13-5-9-15-10-6-13)17-19(3,4)14-7-11-16-12-8-14/h5-12H,1-4H3 |
| InChIKey | YUOBJQMMPCRYLB-UHFFFAOYSA-N |
| Density | 1.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.986°C at 760 mmHg (Cal.) |
| Flash point | 158.814°C (Cal.) |
| Refractive index | 1.52 (Cal.) |
| (1) | Jungmin Ahn, Sung Min Kim, Tae Hwan Noh and Ok-Sang Jung. Pseudorotaxane-type n-hydrocarbon container. Metallacyclodimer of ionic palladium(ii) complexes containing 1,3-bis(4-pyridyl)tetramethyldisiloxane, Dalton Trans., 2011, 40, 8520. |
|---|---|
| Market Analysis Reports |