| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-Sulfobenzoate |
|---|---|
| Synonyms | P-Sulfobenzoic Acid; Para-Sulfobenzoic Acid; Para-Sulphobenzoic Acid |
| Molecular Formula | C7H6O5S |
| Molecular Weight | 202.18 |
| CAS Registry Number | 636-78-2 |
| SMILES | C1=C([S](O)(=O)=O)C=CC(=C1)C(=O)O |
| InChI | 1S/C7H6O5S/c8-7(9)5-1-3-6(4-2-5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12) |
| InChIKey | HWAQOZGATRIYQG-UHFFFAOYSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| SDS | Available |
|---|---|
| (1) | Ren-Gen Xiong, Jing Zhang, Zhen-Feng Chen, Xiao-Zeng You, Chi-Ming Che and Hoong-Kun Fun. In situ ligand synthesis and the first crystallographically characterized lanthanide 3-D pillared networks containing benzene-1,4-disulfonate as a building block, Dalton Trans., 2001, 0, 780. |
|---|---|
| Market Analysis Reports |