|
CAS#: 63641-63-4 Product: 2-Methylbenzene-1,3-Diamine Propylene Oxide Polymer No suppilers available for the product. |
| Name | 2-Methylbenzene-1,3-Diamine Propylene Oxide Polymer |
|---|---|
| Synonyms | (3-Amino-2-Methyl-Phenyl)Amine; 2-Methyloxirane; 1,3-Benzenediamine, Ar-Methyl-, Polymer With Methyloxirane; Toluenediamine, Propylene Oxide Polymer |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 |
| CAS Registry Number | 63641-63-4 |
| SMILES | CC1OC1.C2=CC=C(N)C(=C2N)C |
| InChI | 1S/C7H10N2.C3H6O/c1-5-6(8)3-2-4-7(5)9;1-3-2-4-3/h2-4H,8-9H2,1H3;3H,2H2,1H3 |
| InChIKey | BOVXTTMNGZVIGB-UHFFFAOYSA-N |
| Boiling point | 284.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 148.3°C (Cal.) |
| Market Analysis Reports |