|
CAS#: 6374-49-8 Product: 8-Fluoranthenebutanoic Acid No suppilers available for the product. |
| Name | 8-Fluoranthenebutanoic Acid |
|---|---|
| Synonyms | 4-(8-Fluoranthenyl)Butanoic Acid; 4-Fluoranthen-8-Ylbutyric Acid; 8-Fluoranthenebutanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 |
| CAS Registry Number | 6374-49-8 |
| SMILES | C1=C2C(=CC=C1CCCC(=O)O)C4=C3C2=CC=CC3=CC=C4 |
| InChI | 1S/C20H16O2/c21-19(22)9-1-4-13-10-11-15-16-7-2-5-14-6-3-8-17(20(14)16)18(15)12-13/h2-3,5-8,10-12H,1,4,9H2,(H,21,22) |
| InChIKey | XBGXOGIDGYOHQA-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.9°C at 760 mmHg (Cal.) |
| Flash point | 412.333°C (Cal.) |
| (1) | Chun Zhou and Huisheng Zhuang. Determination of fluoranthene by antigen-coated indirect competitive real-time immuno-PCR assay, J. Environ. Monit., 2009, 11, 400. |
|---|---|
| Market Analysis Reports |