| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Methyl-2-(1-Methylpropyl)-1,3-Propanediol Dicarbamate |
|---|---|
| Synonyms | [2-(Carbamoyloxymethyl)-2,3-Dimethyl-Pentyl] Carbamate; Carbamic Acid [2-(Carbamoyloxymethyl)-2,3-Dimethylpentyl] Ester; Carbamic Acid [2-(Carbamoyloxymethyl)-2,3-Dimethyl-Pentyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 64-55-1 |
| EINECS | 200-587-5 |
| SMILES | C(C(C(CC)C)(COC(N)=O)C)OC(N)=O |
| InChI | 1S/C10H20N2O4/c1-4-7(2)10(3,5-15-8(11)13)6-16-9(12)14/h7H,4-6H2,1-3H3,(H2,11,13)(H2,12,14) |
| InChIKey | LEROTMJVBFSIMP-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 92°C (Expl.) |
| Boiling point | 435.0±28.0°C at 760 mmHg (Cal.) |
| Flash point | 216.8±20.3°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 2800 Details |
|---|---|
| CSA Schedule: IV | |
| Is Narcotics? No | |
| (1) | Yasser Gaber, Ulrika Törnvall, Cecilia Orellana-Coca, Magdy Ali Amin and Rajni Hatti-Kaul. Enzymatic synthesis of N-alkanoyl-N-methylglucamide surfactants: solvent-free production and environmental assessment, Green Chem., 2010, 12, 1817. |
|---|---|
| Market Analysis Reports |