| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | 5-[Amino(carboxy)methyl]-2-hydroxybenzoic acid |
| Synonyms | (R)-3-Carboxy-4-hydroxyphenylglycine; (RS)-3-Carboxy-4-hydroxyphenylglycine; (S)-3-Carboxy-4-hydroxyphenylglycine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| CAS Registry Number | 64043-84-1 |
| SMILES | O=C(O)c1cc(ccc1O)C(C(=O)O)N |
| InChI | 1S/C9H9NO5/c10-7(9(14)15)4-1-2-6(11)5(3-4)8(12)13/h1-3,7,11H,10H2,(H,12,13)(H,14,15) |
| InChIKey | CHZBCZTXSTWCIG-UHFFFAOYSA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.357°C at 760 mmHg (Cal.) |
| Flash point | 235.844°C (Cal.) |
| solubility | Soluble to 100 mM in 1eq. NaOH |
| Market Analysis Reports |