|
CAS#: 64048-96-0 Product: Tris(2-Furyl)Arsine No suppilers available for the product. |
| Name | Tris(2-Furyl)Arsine |
|---|---|
| Synonyms | Tris(2-Furyl)Arsane; Tri-Alpha-Furyl Arsine; 4-18-00-08364 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9AsO3 |
| Molecular Weight | 276.12 |
| CAS Registry Number | 64048-96-0 |
| SMILES | C3=C([As](C1=CC=CO1)C2=CC=CO2)OC=C3 |
| InChI | 1S/C12H9AsO3/c1-4-10(14-7-1)13(11-5-2-8-15-11)12-6-3-9-16-12/h1-9H |
| InChIKey | APHAJJNALMMZLB-UHFFFAOYSA-N |
| Boiling point | 301.57°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 137.457°C (Cal.) |
| (1) | Uwe V. Monkowius, Stefan Nogai and Hubert Schmidbaur. Unsuccessful/successful attempts to produce penta(heteroaryl)-phosphoranes/-arsoranes RE (E = P, As; R = 2-furyl, 2-thienyl), Dalton Trans., 2004, 0, 1610. |
|---|---|
| Market Analysis Reports |