|
CAS#: 6415-02-7 Product: 1,1',1''-Phosphinetriyltripyrrolidine No suppilers available for the product. |
| Name | 1,1',1''-Phosphinetriyltripyrrolidine |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24N3P |
| Molecular Weight | 241.31 |
| CAS Registry Number | 6415-02-7 |
| EINECS | 229-118-2 |
| SMILES | C1CCN(C1)P(N2CCCC2)N3CCCC3 |
| InChI | 1S/C12H24N3P/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15/h1-12H2 |
| InChIKey | PXFLCAQHOZXYED-UHFFFAOYSA-N |
| Boiling point | 318.3±9.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 146.3±18.7°C (Cal.) |
| (1) | Matthew L. Clarke, Gemma L. Holliday, Alexandra M. Z. Slawin and J. Derek Woollins. Highly electron rich alkyl- and dialkyl-N-pyrrolidinyl phosphines: an evaluation of their electronic and structural properties, Dalton Trans., 2002, 0, 1093. |
|---|---|
| Market Analysis Reports |