| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | N-Nitroaniline |
|---|---|
| Synonyms | Benzenamine, N-Nitro-; N-Nitroaniline [Forbidden]; Aniline, N-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 |
| CAS Registry Number | 645-55-6 |
| SMILES | C1=C(N[N+]([O-])=O)C=CC=C1 |
| InChI | 1S/C6H6N2O2/c9-8(10)7-6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | VBEGHXKAFSLLGE-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.719°C at 760 mmHg (Cal.) |
| Flash point | 103.617°C (Cal.) |
| (1) | G. Couderc and J. Hulliger. Channel forming organic crystals: guest alignment and properties, Chem. Soc. Rev., 2010, 39, 1545. |
|---|---|
| Market Analysis Reports |