| Shanghai Biosundrug Science & Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.biosundrug.com | |||
![]() | +86 (21) 3462-2192 | |||
![]() | +86 (21) 3462-2765 | |||
![]() | fy@biosundrug.com | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink Standard supplier since 2006 | ||||
| Simagchem Corporation | China | |||
|---|---|---|---|---|
![]() | www.simagchem.com | |||
![]() | +86 13806087780 | |||
![]() | +86 (592) 268-0237 | |||
![]() | sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink Standard supplier since 2008 | ||||
| Hengshui Haoye Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.chemcoms.com | |||
![]() | +86 (318) 210-2300 +86 18632882519 | |||
![]() | +86 (318) 210-3390 | |||
![]() | firmcn@gmail.com | |||
| Chemical distributor | ||||
| chemBlink Standard supplier since 2011 | ||||
| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() | www.carbosynth.cn | |||
![]() | +86 (512) 6260-5585 | |||
![]() | +86 (512) 6260-5576 | |||
![]() | sales@carbosynth.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2006 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Ketone compound |
|---|---|
| Name | 2'-Ethoxycarbonylmethoxy-4'-(3-methyl-2-butenyloxy) acetophenone |
| Synonyms | 2'-Ethoxycarbonylmethoxy-4'-(3-Methyl-2-butyenyl-oxy)acetophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.35 |
| CAS Registry Number | 64506-46-3 |
| SMILES | CCOC(=O)COC1=C(C=CC(=C1)OCC=C(C)C)C(=O)C |
| Hazard Symbols | |
|---|---|
| Risk Statements | H317-H319 Details |
| Safety Statements | P280-P305+P351+P351 Details |
| SDS | Available |
|
2'-Ethoxycarbonylmethoxy-4'-(3-methyl-2-butenyloxy) acetophenone is a synthetic organic compound that was first synthesized in the pursuit of developing novel molecules with potential pharmaceutical and material science applications. This compound features a complex structure with multiple functional groups, including an ethoxycarbonylmethoxy moiety and a butenyloxy substituent on the acetophenone core. The synthesis and characterization of this compound were achieved through advanced organic synthesis techniques, including esterification and etherification reactions, followed by verification using spectroscopic methods like NMR and MS. The discovery of this compound highlights the innovation in organic chemistry aimed at creating molecules with specific functional properties. This compound serves as an important intermediate in pharmaceutical synthesis. Its unique structure allows it to participate in various chemical reactions, making it a valuable building block for the synthesis of complex bioactive molecules. Researchers explore its potential in developing new drugs targeting conditions such as cancer, inflammation, and infectious diseases. Its ability to form stable derivatives and conjugates enhances its utility in drug design and development. In material science, 2'-ethoxycarbonylmethoxy-4'-(3-methyl-2-butenyloxy) acetophenone is utilized in the development of advanced polymers and coatings. Its functional groups enable it to be incorporated into polymer backbones, imparting specific properties such as flexibility, durability, and chemical resistance. These materials find applications in high-performance coatings, adhesives, and specialty plastics. The agrochemical industry benefits from this compound as a precursor in the synthesis of herbicides, insecticides, and fungicides. Its structural complexity allows for the creation of active ingredients that can effectively protect crops from pests and diseases. These agrochemicals help improve agricultural productivity and sustainability by ensuring healthier and more resilient crops. Due to its ester and ether functionalities, 2'-ethoxycarbonylmethoxy-4'-(3-methyl-2-butenyloxy) acetophenone is valuable in the flavor and fragrance industry. It can be used to synthesize aroma compounds that add distinct fruity or floral notes to perfumes, cosmetics, and food products. Its contribution to sensory characteristics enhances the appeal of consumer products. This compound is a subject of interest in academic and industrial chemical research. Its versatile reactivity and complex structure make it an ideal candidate for studying reaction mechanisms and developing new synthetic methodologies. Researchers use it to explore novel chemical transformations and to design compounds with specific desired properties. References 2007. Ethyl 2-[2-acetyl-5-(3-methylbut-2-enyloxy)phenoxy]acetate. Acta Crystallographica Section E Structure Reports Online, 63(10). DOI: 10.1107/s1600536807041530 |
| Market Analysis Reports |