|
CAS#: 64536-06-7 Product: Ethenyl-Benzene Polymer With 1-Methyl-4-(1-Methylethenyl)Cyclohexene No suppilers available for the product. |
| Name | Ethenyl-Benzene Polymer With 1-Methyl-4-(1-Methylethenyl)Cyclohexene |
|---|---|
| Synonyms | 4-Isopropenyl-1-Methyl-Cyclohexene; Styrene; 4-Isopropenyl-1-Methylcyclohexene; Styrene; Ethenylbenzene; 1-Methyl-4-Prop-1-En-2-Yl-Cyclohexene |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 |
| CAS Registry Number | 64536-06-7 |
| SMILES | CC(C1CC=C(CC1)C)=C.C2=C(C=CC=C2)C=C |
| InChI | 1S/C10H16.C8H8/c1-8(2)10-6-4-9(3)5-7-10;1-2-8-6-4-3-5-7-8/h4,10H,1,5-7H2,2-3H3;2-7H,1H2 |
| InChIKey | SQGKYTCDBJHLJI-UHFFFAOYSA-N |
| Boiling point | 175.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 42.8°C (Cal.) |
| Market Analysis Reports |