| MolScanner | Singapore | |||
|---|---|---|---|---|
![]() | www.molscanner.com | |||
![]() | +86 18621675448 | |||
![]() | marketing@molscanner.com | |||
![]() | WhatsApp:9896 7603 | |||
| Chemical manufacturer since 2025 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | tert-Butyl N-((1S,3S)-3-aminocyclopentyl)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 645400-44-8 |
| EC Number | 863-264-3 |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C1)N |
| Density | 1.0±0.1 g/cm3 Calc.* |
|---|---|
| Boiling point | 304.2±31.0 °C 760 mmHg (Calc.)* |
| Flash point | 137.8±24.8 °C (Calc.)* |
| Index of refraction | 1.489 (Calc.)* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H318-H319-H335 Details | ||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P305+P354+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
|
tert-Butyl N-((1S,3S)-3-aminocyclopentyl)carbamate is a chiral organic compound consisting of a carbamate group attached to a tert-butyl group and a cyclopentylamine moiety. The structure is characterized by a cyclopentyl ring with an amino group at the 3-position and a carbamate group (–NH–COO–) at the nitrogen of the attached amine. The stereochemistry of the compound is specified by the (1S,3S) configuration at the cyclopentyl ring, meaning the molecule adopts a particular three-dimensional arrangement around the stereocenters at positions 1 and 3. The discovery and application of tert-butyl N-((1S,3S)-3-aminocyclopentyl)carbamate arise from its potential use in pharmaceutical synthesis and the design of biologically active molecules. The chiral nature of the compound plays a crucial role in determining its activity, as stereochemistry profoundly influences the binding of molecules to biological targets such as receptors, enzymes, and transporters. Carbamate derivatives like this are widely studied for their ability to form stable, bioactive intermediates and serve as key functional groups in drug development. The inclusion of the cyclopentyl ring in the structure contributes to the overall rigidity of the molecule, which can enhance selectivity and affinity toward specific biological targets. The amino group on the cyclopentyl ring can also participate in hydrogen bonding interactions, contributing to the compound’s biological activity. Synthetically, tert-butyl N-((1S,3S)-3-aminocyclopentyl)carbamate is typically prepared through the reaction of a suitable amine, in this case, a (1S,3S)-3-aminocyclopentyl derivative, with a tert-butyl isocyanate. This results in the formation of the carbamate group, with the chiral centers maintained by using enantioselective synthetic methods or by starting from a chiral precursor. The carbamate group is useful in the synthesis of further derivatives, as it is both a relatively stable functional group and a good leaving group in various chemical reactions, such as nucleophilic substitution or hydrolysis. In the context of medicinal chemistry, such carbamate-containing compounds are of interest for their potential to act as inhibitors, ligands, or scaffolds for designing new therapeutic agents. The use of a cyclopentyl ring in drug discovery is significant because the rigidity it imparts can help optimize receptor binding by restricting conformational flexibility, potentially improving pharmacodynamics. Moreover, the aminocyclopentyl group may be involved in creating interactions with active sites of enzymes or receptors, further enhancing the bioactivity of compounds derived from this structure. This type of chiral carbamate is also employed as a building block for larger, more complex molecular architectures. The presence of both the tert-butyl group and the cyclopentylamine moiety may aid in modulating the solubility and stability of molecules in biological environments, which is essential for improving pharmacokinetic properties in drug candidates. Overall, tert-butyl N-((1S,3S)-3-aminocyclopentyl)carbamate serves as an important intermediate in synthetic chemistry with applications in medicinal chemistry, where it aids in the development of compounds targeting specific biological functions. Its use as a stable, chiral intermediate makes it a valuable component in the design of selective and potent pharmaceuticals. References none |
| Market Analysis Reports |