|
CAS#: 6495-46-1 Product: Dioxadrol No suppilers available for the product. |
| Name | Dioxadrol |
|---|---|
| Synonyms | 1,3-Dioxolane, 2,2-Diphenyl-4-(2'-Piperidyl)-; Oprea1_541095; 2,2-Diphenyl-4-(2'-Piperidyl)-1,3-Dioxolane |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 |
| CAS Registry Number | 6495-46-1 |
| SMILES | C4=C(C3(C1=CC=CC=C1)OC(C2CCCCN2)CO3)C=CC=C4 |
| InChI | 1S/C20H23NO2/c1-3-9-16(10-4-1)20(17-11-5-2-6-12-17)22-15-19(23-20)18-13-7-8-14-21-18/h1-6,9-12,18-19,21H,7-8,13-15H2 |
| InChIKey | HGKAMARNFGKMLC-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 187.1±18.2°C (Cal.) |
| (1) | Ashutosh Banerjee, Roland Fröhlich, Dirk Schepmann and Bernhard Wünsch. Synthesis and NMDA receptor affinity of dexoxadrol analogues with modifications in position 4 of the piperidine ring, Med. Chem. Commun., 2010, 1, 87. |
|---|---|
| Market Analysis Reports |