| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Methyl (2-Acetyl-3,5-Dimethoxyphenyl)Acetate |
|---|---|
| Synonyms | Benzeneacetic acid, 2-acetyl-3,5-dimethoxy-, methyl ester; Benzeneaceticacid,2-acetyl-3,5-dimethoxy-,methylester; Methyl 2-(2-acetyl-3,5-dimethoxyphenyl)acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.26 |
| CAS Registry Number | 6512-33-0 |
| SMILES | O=C(OC)Cc1cc(OC)cc(OC)c1C(=O)C |
| InChI | 1S/C13H16O5/c1-8(14)13-9(6-12(15)18-4)5-10(16-2)7-11(13)17-3/h5,7H,6H2,1-4H3 |
| InChIKey | CNSJQKGHRYHGCM-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.868°C at 760 mmHg (Cal.) |
| Flash point | 204.568°C (Cal.) |
| (1) | Andrew Michael Beekman, Edwin Castillo Martinez and Russell Allan Barrow. First syntheses of the biologically active fungal metabolites pestalotiopsones A, B, C and F, Org. Biomol. Chem., 2013, 11, 1109. |
|---|---|
| Market Analysis Reports |