| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2,2'-Methylenedianiline |
|---|---|
| Synonyms | [2-(2-Aminobenzyl)Phenyl]Amine; 2,2'-Methylenebis(Benzeneamine); 2,2'-Methylenedianiline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 |
| CAS Registry Number | 6582-52-1 |
| EINECS | 229-512-4 |
| SMILES | C2=C(CC1=CC=CC=C1N)C(=CC=C2)N |
| InChI | 1S/C13H14N2/c14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1-8H,9,14-15H2 |
| InChIKey | OHKOAJUTRVTYSW-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Melting point | 55°C (Expl.) |
| Boiling point | 390.189°C at 760 mmHg (Cal.) |
| Flash point | 226.767°C (Cal.) |
| (1) | Kirsi Säkkinen, Jarkko Tornaeus, Antti Hesso, Ari Hirvonen, Harri Vainio, Hannu Norppa and Christina Rosenberg. Protein adducts as biomarkers of exposure to aromatic diisocyanates in workers manufacturing polyurethane (PUR) foam, J. Environ. Monit., 2011, 13, 957. |
|---|---|
| Market Analysis Reports |