| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Diethoxy-(6-Methyl-2-Propan-2-Yl-Pyrimidin-4-Yl)Oxy-Sulfanylidene-Phosphorane |
|---|---|
| Synonyms | Diethoxy-(2-Isopropyl-6-Methyl-Pyrimidin-4-Yl)Oxy-Thioxo-Phosphorane; Diethoxy-[(2-Isopropyl-6-Methyl-4-Pyrimidinyl)Oxy]-Thioxophosphorane; Diethoxy-(6-Methyl-2-Propan-2-Yl-Pyrimidin-4-Yl)Oxy-Sulfanylidene-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21N2O3PS |
| Molecular Weight | 304.34 |
| CAS Registry Number | 65863-03-8 |
| SMILES | C1=C(C)N=C(N=C1O[P](OCC)(OCC)=S)C(C)C |
| InChI | 1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3 |
| InChIKey | FHIVAFMUCKRCQO-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.9±44.0°C at 760 mmHg (Cal.) |
| Flash point | 167.9±28.4°C (Cal.) |
| 82.2222°C (Expl.) | |
| solubility | 0.004% |
| (1) | Isaac Adebayo Akinbulu and Tebello Nyokong. Fabrication and characterization of single walled carbon nanotubes-iron phthalocyanine nano-composite: surface properties and electron transport dynamics of its self assembled monolayer film, New J. Chem., 2010, 34, 2875. |
|---|---|
| Market Analysis Reports |