| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluoropropane series |
|---|---|
| Name | 1,2-Dibromohexafluoropropane |
| Synonyms | 1,2-Dibromo-1,1,2,3,3,3-Hexafluoro-Propane; 1,2-Dibromohexafluoropropane; 4-01-00-00218 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C3Br2F6 |
| Molecular Weight | 309.83 |
| CAS Registry Number | 661-95-0 |
| EINECS | 211-550-8 |
| SMILES | FC(C(F)(F)F)(C(F)(F)Br)Br |
| InChI | 1S/C3Br2F6/c4-1(6,2(5,7)8)3(9,10)11 |
| InChIKey | KTULQNFKNLFOHL-UHFFFAOYSA-N |
| Density | 2.3±0.1g/cm3 (Cal.) |
|---|---|
| 2.169 (Expl.) | |
| Melting point | -94.4°C (Expl.) |
| Boiling point | 72.5°C (Expl.) |
| 72.6±8.0°C at 760 mmHg (Cal.) | |
| Flash point | -2.3±18.4°C (Cal.) |
| Refractive index | 1.3591 (Expl.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| SDS | Available |
| Market Analysis Reports |