| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Fentin |
|---|---|
| Synonyms | Snph3(+); [Snph3](+); Triphenyltin(1+) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15Sn |
| Molecular Weight | 350.01 |
| CAS Registry Number | 668-34-8 |
| SMILES | C1=CC=CC=C1[Sn+](C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/3C6H5.Sn/c3*1-2-4-6-5-3-1;/h3*1-5H;/q;;;+1 |
| InChIKey | XBRCDWHXULVEFB-UHFFFAOYSA-N |
| (1) | Christopher Harman, Olav Bøyum, Knut Erik Tollefsen, Kevin Thomas and Merete Grung. Uptake of some selected aquatic pollutants in semipermeable membrane devices (SPMDs) and the polar organic chemical integrative sampler (POCIS), J. Environ. Monit., 2008, 10, 239. |
|---|---|
| Market Analysis Reports |