| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Name | 4-(3,6-Dihydroxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[a]Phenanthren-17-Yl)Pentanoic Acid |
|---|---|
| Synonyms | 4-(3,6-Dihydroxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)Valeric Acid; Nsc18166; Nciopen2_007753 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 |
| CAS Registry Number | 668-49-5 |
| SMILES | C(C(C4C3(C(C2C(C1(C(CC(O)CC1)C(C2)O)C)CC3)CC4)C)C)CC(=O)O |
| InChI | 1S/C24H40O4/c1-14(4-7-22(27)28)17-5-6-18-16-13-21(26)20-12-15(25)8-10-24(20,3)19(16)9-11-23(17,18)2/h14-21,25-26H,4-13H2,1-3H3,(H,27,28) |
| InChIKey | DGABKXLVXPYZII-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.148°C at 760 mmHg (Cal.) |
| Flash point | 298.768°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |