|
CAS#: 66898-39-3 Product: 3-Ethylchromen-2-One No suppilers available for the product. |
| Name | 3-Ethylchromen-2-One |
|---|---|
| Synonyms | 3-Ethyl-2-Chromenone; 3-Ethylcoumarin; 2H-1-Benzopyran-2-One, 3-Ethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 66898-39-3 |
| SMILES | C1=CC=CC2=C1C=C(C(O2)=O)CC |
| InChI | 1S/C11H10O2/c1-2-8-7-9-5-3-4-6-10(9)13-11(8)12/h3-7H,2H2,1H3 |
| InChIKey | LKAXCASKXOSFIU-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.999°C at 760 mmHg (Cal.) |
| Flash point | 126.727°C (Cal.) |
| (1) | Yuansong Jiang, Wanzhi Chen and Weimin Lu. N-Heterocyclic carbene catalyzed conjugate umpolung reactions leading to coumarin derivatives, RSC Advances, 2012, 2, 1540. |
|---|---|
| Market Analysis Reports |