| YURUI (Shanghai) Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.riyngroup.com | |||
![]() | +86 (21) 3319-1321 ex 816 +86 13032131612 | |||
![]() | +86 (21) 6085-3441 | |||
![]() | yu@riyngroup.com info@riyngroup.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2008 | ||||
| Zhengzhou Alfachem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.alfachemch.com | |||
![]() | +86 (0371) 5505-2911 | |||
![]() | alfa5@alfachem.cn | |||
| Chemical manufacturer since 2010 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Fluorenes |
|---|---|
| Name | 2,7-Dibromo-N,N,N',N'-tetramethyl-9H-fluorene-9,9-dipropanamine polymer with 2,2'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] |
| Synonyms | Poly[(9,9-bis(3 inverted exclamation marka-(N,N -dimethylamino)propyl)-2,7-fluorene)-alt- 2,7-(9,9-dioctylfluorene)] |
| Molecular Structure | ![]() |
| Molecular Formula | (C41H64B2O4)x.(C23H30Br2N2)x |
| CAS Registry Number | 673474-74-3 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=C(C3(CCCCCCCC)CCCCCCCC)C=C(C=C4)B5OC(C(O5)(C)C)(C)C.CN(C)CCCC1(C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br)CCCN(C)C |
|
2,7-Dibromo-N,N,N',N'-tetramethyl-9H-fluorene-9,9-dipropanamine polymer with 2,2'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is a sophisticated organic polymer that has attracted attention in the field of material science and optoelectronics. This compound, which integrates various organic and inorganic components, exhibits a range of properties that make it suitable for advanced applications in the fields of polymer electronics, organic light-emitting diodes (OLEDs), and photovoltaic devices. The discovery of this polymer is linked to the exploration of fluorene-based materials, which are known for their excellent electronic properties. Fluorene derivatives, especially those functionalized with bromine or other reactive groups, are commonly used in organic semiconductors due to their stability and efficient charge transport characteristics. The incorporation of N,N,N',N'-tetramethyl-9H-fluorene-9,9-dipropanamine into the polymer structure enhances its electronic and photonic properties, making it useful in electronic devices that require efficient charge injection and transport. The key component of this polymer is the 2,7-dibromo-N,N,N',N'-tetramethyl-9H-fluorene-9,9-dipropanamine, which serves as the core structure. This fluorene-based unit is highly conjugated, which allows it to exhibit strong photoluminescence and high charge carrier mobility. The addition of 2,2'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] introduces boron atoms into the polymer network. The boron-containing groups facilitate the formation of a stable polymeric structure and improve the material's ability to form donor-acceptor interactions within optoelectronic applications. The presence of the dioctyl groups also enhances the solubility of the polymer, making it easier to process and fabricate into devices. One of the major applications of this polymer is in the development of organic light-emitting diodes (OLEDs). OLEDs are a type of display technology used in televisions, smartphones, and other digital devices. They rely on the efficient injection and transport of charges through organic materials to emit light. The conjugated structure of the fluorene-based polymer in this compound allows for efficient charge transport, making it an ideal candidate for use in the active layers of OLEDs. The boron-based components improve the stability and performance of the OLEDs, enhancing their lifespan and light output efficiency. Another potential application of this polymer is in organic photovoltaic devices (OPVs), which convert solar energy into electricity. The polymer's ability to efficiently transport charges and its strong light absorption properties make it suitable for use in the active layers of OPVs. In these devices, the polymer helps to enhance the absorption of sunlight and improve the overall efficiency of the energy conversion process. Additionally, the unique chemical structure of the polymer makes it an attractive material for use in sensors and other electronic devices. Its ability to undergo charge transfer and emit light in response to external stimuli makes it suitable for use in biosensors, chemical sensors, and other detection systems. The material's photonic properties also open up possibilities for its use in optoelectronic applications, where light manipulation is essential. In conclusion, 2,7-Dibromo-N,N,N',N'-tetramethyl-9H-fluorene-9,9-dipropanamine polymer with 2,2'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is a highly versatile material that has significant potential in optoelectronics, organic photovoltaics, and sensor technology. Its combination of conjugated structures, charge transport properties, and photonic characteristics make it an important material for the development of advanced electronic devices. References none |
| Market Analysis Reports |